C26H28O11 — CID 70412899
3-[(3,4-dimethoxyphenyl)methoxycarbonyl]-5,6,7-trimethoxy-1-(methoxymethoxy)naphthalene-2-carboxylic acid (PubChem CID 70412899) has the molecular formula C26H28O11 and a molecular weight of 516.50 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methoxycarbonyl]-5,6,7-trimethoxy-1-(methoxymethoxy)naphthalene-2-carboxylic acid.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methoxycarbonyl]-5,6,7-trimethoxy-1-(methoxymethoxy)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 70412899 |
| Molecular Formula | C26H28O11 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methoxycarbonyl]-5,6,7-trimethoxy-1-(methoxymethoxy)naphthalene-2-carboxylic acid |
| SMILES | COCOc1c(C(=O)O)c(C(=O)OCc2ccc(OC)c(OC)c2)cc2c(OC)c(OC)c(OC)cc12 |
| InChI | InChI=1S/C26H28O11/c1-30-13-37-22-16-11-20(33-4)24(35-6)23(34-5)15(16)10-17(21(22)25(27)28)26(29)36-12-14-7-8-18(31-2)19(9-14)32-3/h7-11H,12-13H2,1-6H3,(H,27,28) |
| InChIKey | NCESENSEKSAZKV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|