C15H18N2O — CID 70412967
6-prop-2-enyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-5-ol (PubChem CID 70412967) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 6-prop-2-enyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-5-ol.
| Compound Name | 6-prop-2-enyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-5-ol |
|---|---|
| PubChem CID | 70412967 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 6-prop-2-enyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-5-ol |
| SMILES | C=CCn1c2c(c3ccccc31)CCNCC2O |
| InChI | InChI=1S/C15H18N2O/c1-2-9-17-13-6-4-3-5-11(13)12-7-8-16-10-14(18)15(12)17/h2-6,14,16,18H,1,7-10H2 |
| InChIKey | SGONBESOJLFHNY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|