C21H34O3 — CID 70413011
(2E,7E,11E)-3,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one (PubChem CID 70413011) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2E,7E,11E)-3,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one.
| Compound Name | (2E,7E,11E)-3,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one |
|---|---|
| PubChem CID | 70413011 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2E,7E,11E)-3,7,11-trimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one |
| SMILES | C/C=C(\C)C(=O)CC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C21H34O3/c1-5-19(4)20(22)13-12-17(2)9-8-10-18(3)14-16-24-21-11-6-7-15-23-21/h5,9,14,21H,6-8,10-13,15-16H2,1-4H3/b17-9+,18-14+,19-5+ |
| InChIKey | DKDKTPNJJYVRHY-FDIBJAEKSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|