C20H34O3 — CID 70413294
2-methyl-14-(oxan-2-yloxy)tetradeca-3,8,12-trien-5-ol (PubChem CID 70413294) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-methyl-14-(oxan-2-yloxy)tetradeca-3,8,12-trien-5-ol.
| Compound Name | 2-methyl-14-(oxan-2-yloxy)tetradeca-3,8,12-trien-5-ol |
|---|---|
| PubChem CID | 70413294 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-methyl-14-(oxan-2-yloxy)tetradeca-3,8,12-trien-5-ol |
| SMILES | CC(C)C=CC(O)CCC=CCCC=CCOC1CCCCO1 |
| InChI | InChI=1S/C20H34O3/c1-18(2)14-15-19(21)12-8-6-4-3-5-7-10-16-22-20-13-9-11-17-23-20/h4,6-7,10,14-15,18-21H,3,5,8-9,11-13,16-17H2,1-2H3 |
| InChIKey | BKONJXQDABLULD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|