About [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate
[1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate (PubChem CID 70413304) has the molecular formula C11H10ClF3N2O5S
and a molecular weight of 374.72 g/mol. Its IUPAC name is [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate |
| PubChem CID | 70413304 |
| Molecular Formula | C11H10ClF3N2O5S |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate |
| SMILES | NC(OC(=O)C(F)(F)F)C(Cl)CS(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H10ClF3N2O5S/c12-8(9(16)22-10(18)11(13,14)15)5-23(21)7-3-1-6(2-4-7)17(19)20/h1-4,8-9H,5,16H2 |
| InChIKey | UFKARQAFEMZRNF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate?
The IUPAC name of [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate (CID 70413304) is [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate is NC(OC(=O)C(F)(F)F)C(Cl)CS(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate?
The InChIKey is UFKARQAFEMZRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF3N2O5S/c12-8(9(16)22-10(18)11(13,14)15)5-23(21)7-3-1-6(2-4-7)17(19)20/h1-4,8-9H,5,16H2.
What are the key properties of [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate?
[1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate has a molecular weight of 374.72 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-2-chloro-3-(4-nitrophenyl)sulfinylpropyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 70413304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).