About 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid
5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid (PubChem CID 70413311) has the molecular formula C27H41NO3S
and a molecular weight of 459.70 g/mol. Its IUPAC name is 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid.
Molecular Properties
| Compound Name | 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid |
| PubChem CID | 70413311 |
| Molecular Formula | C27H41NO3S |
| Molecular Weight | 459.70 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid |
| SMILES | CCCCC(Sc1ccccc1N)C(O)CCCc1ccccc1.CCCCCC(=O)O |
| InChI | InChI=1S/C21H29NOS.C6H12O2/c1-2-3-15-21(24-20-16-8-7-13-18(20)22)19(23)14-9-12-17-10-5-4-6-11-17;1-2-3-4-5-6(7)8/h4-8,10-11,13,16,19,21,23H,2-3,9,12,14-15,22H2,1H3;2-5H2,1H3,(H,7,8) |
| InChIKey | RBUZOCXKBRQSMQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.70 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid?
The IUPAC name of 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid (CID 70413311) is 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid.
What is the SMILES notation for 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid?
The canonical SMILES for 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid is CCCCC(Sc1ccccc1N)C(O)CCCc1ccccc1.CCCCCC(=O)O.
What is the InChIKey of 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid?
The InChIKey is RBUZOCXKBRQSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NOS.C6H12O2/c1-2-3-15-21(24-20-16-8-7-13-18(20)22)19(23)14-9-12-17-10-5-4-6-11-17;1-2-3-4-5-6(7)8/h4-8,10-11,13,16,19,21,23H,2-3,9,12,14-15,22H2,1H3;2-5H2,1H3,(H,7,8).
What are the key properties of 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid?
5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid has a molecular weight of 459.70 g/mol, XLogP of 6.95, 14 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid is sourced from PubChem (CID 70413311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).