About [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid
[1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid (PubChem CID 70413591) has the molecular formula C15H11NO5
and a molecular weight of 285.26 g/mol. Its IUPAC name is [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid.
Molecular Properties
| Compound Name | [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid |
| PubChem CID | 70413591 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc2c(c1)oc1ccncc12 |
| InChI | InChI=1S/C11H7NO.C4H4O4/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10;5-3(6)1-2-4(7)8/h1-7H;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | HHJVGRWZTQNQRH-BTJKTKAUSA-N |
| XLogP | 2.69 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid?
The IUPAC name of [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid (CID 70413591) is [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid.
What is the SMILES notation for [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid?
The canonical SMILES for [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid is O=C(O)/C=C\C(=O)O.c1ccc2c(c1)oc1ccncc12.
What is the InChIKey of [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid?
The InChIKey is HHJVGRWZTQNQRH-BTJKTKAUSA-N. The full InChI is InChI=1S/C11H7NO.C4H4O4/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10;5-3(6)1-2-4(7)8/h1-7H;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid?
[1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid has a molecular weight of 285.26 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[3,2-c]pyridine;(Z)-but-2-enedioic acid is sourced from PubChem (CID 70413591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).