About cyclobutane;6-nitro-2,1-benzoxazole
cyclobutane;6-nitro-2,1-benzoxazole (PubChem CID 70414206) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is cyclobutane;6-nitro-2,1-benzoxazole.
Molecular Properties
| Compound Name | cyclobutane;6-nitro-2,1-benzoxazole |
| PubChem CID | 70414206 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | cyclobutane;6-nitro-2,1-benzoxazole |
| SMILES | C1CCC1.O=[N+]([O-])c1ccc2conc2c1 |
| InChI | InChI=1S/C7H4N2O3.C4H8/c10-9(11)6-2-1-5-4-12-8-7(5)3-6;1-2-4-3-1/h1-4H;1-4H2 |
| InChIKey | OVYKRCJXJIGKQP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;6-nitro-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;6-nitro-2,1-benzoxazole?
The IUPAC name of cyclobutane;6-nitro-2,1-benzoxazole (CID 70414206) is cyclobutane;6-nitro-2,1-benzoxazole.
What is the SMILES notation for cyclobutane;6-nitro-2,1-benzoxazole?
The canonical SMILES for cyclobutane;6-nitro-2,1-benzoxazole is C1CCC1.O=[N+]([O-])c1ccc2conc2c1.
What is the InChIKey of cyclobutane;6-nitro-2,1-benzoxazole?
The InChIKey is OVYKRCJXJIGKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3.C4H8/c10-9(11)6-2-1-5-4-12-8-7(5)3-6;1-2-4-3-1/h1-4H;1-4H2.
What are the key properties of cyclobutane;6-nitro-2,1-benzoxazole?
cyclobutane;6-nitro-2,1-benzoxazole has a molecular weight of 220.23 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;6-nitro-2,1-benzoxazole is sourced from PubChem (CID 70414206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).