About 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride
3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride (PubChem CID 70414230) has the molecular formula C7H10ClN5
and a molecular weight of 199.65 g/mol. Its IUPAC name is 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride |
| PubChem CID | 70414230 |
| Molecular Formula | C7H10ClN5 |
| Molecular Weight | 199.65 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride |
| SMILES | CN(C)C=C(C#N)n1cncn1.Cl |
| InChI | InChI=1S/C7H9N5.ClH/c1-11(2)4-7(3-8)12-6-9-5-10-12;/h4-6H,1-2H3;1H |
| InChIKey | AUDIWLXUCVYULD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.65 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride?
The IUPAC name of 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride (CID 70414230) is 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride?
The canonical SMILES for 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride is CN(C)C=C(C#N)n1cncn1.Cl.
What is the InChIKey of 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride?
The InChIKey is AUDIWLXUCVYULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5.ClH/c1-11(2)4-7(3-8)12-6-9-5-10-12;/h4-6H,1-2H3;1H.
What are the key properties of 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride?
3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride has a molecular weight of 199.65 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-2-(1,2,4-triazol-1-yl)prop-2-enenitrile;hydrochloride is sourced from PubChem (CID 70414230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).