C23H19ClFNO3 — CID 70414341
6-[2-[6-chloro-4-(4-fluorophenyl)-2-methylquinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one (PubChem CID 70414341) has the molecular formula C23H19ClFNO3 and a molecular weight of 411.86 g/mol. Its IUPAC name is 6-[2-[6-chloro-4-(4-fluorophenyl)-2-methylquinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one.
| Compound Name | 6-[2-[6-chloro-4-(4-fluorophenyl)-2-methylquinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 70414341 |
| Molecular Formula | C23H19ClFNO3 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 6-[2-[6-chloro-4-(4-fluorophenyl)-2-methylquinolin-3-yl]ethenyl]-4-hydroxyoxan-2-one |
| SMILES | Cc1nc2ccc(Cl)cc2c(-c2ccc(F)cc2)c1C=CC1CC(O)CC(=O)O1 |
| InChI | InChI=1S/C23H19ClFNO3/c1-13-19(8-7-18-11-17(27)12-22(28)29-18)23(14-2-5-16(25)6-3-14)20-10-15(24)4-9-21(20)26-13/h2-10,17-18,27H,11-12H2,1H3 |
| InChIKey | WRMOSELMQIYDOA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |