C20H27NO4 — CID 70414430
1-[[2-methoxy-2-(3-methoxyphenyl)ethyl]amino]-3-(3-methylphenoxy)propan-2-ol (PubChem CID 70414430) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[[2-methoxy-2-(3-methoxyphenyl)ethyl]amino]-3-(3-methylphenoxy)propan-2-ol.
| Compound Name | 1-[[2-methoxy-2-(3-methoxyphenyl)ethyl]amino]-3-(3-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 70414430 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[[2-methoxy-2-(3-methoxyphenyl)ethyl]amino]-3-(3-methylphenoxy)propan-2-ol |
| SMILES | COc1cccc(C(CNCC(O)COc2cccc(C)c2)OC)c1 |
| InChI | InChI=1S/C20H27NO4/c1-15-6-4-9-19(10-15)25-14-17(22)12-21-13-20(24-3)16-7-5-8-18(11-16)23-2/h4-11,17,20-22H,12-14H2,1-3H3 |
| InChIKey | NUANPBMJTVTXKU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |