About methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one
methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 70414789) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one |
| PubChem CID | 70414789 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)N1CCCC1 |
| InChI | InChI=1S/C7H11NO.C5H8O2/c1-2-7(9)8-5-3-4-6-8;1-4(2)5(6)7-3/h2H,1,3-6H2;1H2,2-3H3 |
| InChIKey | OMQVBFVQSSINEG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one?
The IUPAC name of methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one (CID 70414789) is methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one.
What is the SMILES notation for methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one?
The canonical SMILES for methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one is C=C(C)C(=O)OC.C=CC(=O)N1CCCC1.
What is the InChIKey of methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one?
The InChIKey is OMQVBFVQSSINEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C5H8O2/c1-2-7(9)8-5-3-4-6-8;1-4(2)5(6)7-3/h2H,1,3-6H2;1H2,2-3H3.
What are the key properties of methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one?
methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one has a molecular weight of 225.29 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;1-pyrrolidin-1-ylprop-2-en-1-one is sourced from PubChem (CID 70414789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).