C23H32O3 — CID 70414830
2-[4-(4-octoxyphenyl)phenyl]propane-1,3-diol (PubChem CID 70414830) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-[4-(4-octoxyphenyl)phenyl]propane-1,3-diol.
| Compound Name | 2-[4-(4-octoxyphenyl)phenyl]propane-1,3-diol |
|---|---|
| PubChem CID | 70414830 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-[4-(4-octoxyphenyl)phenyl]propane-1,3-diol |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C23H32O3/c1-2-3-4-5-6-7-16-26-23-14-12-20(13-15-23)19-8-10-21(11-9-19)22(17-24)18-25/h8-15,22,24-25H,2-7,16-18H2,1H3 |
| InChIKey | KPJDZBULHWSPPW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|