C26H26N2O6S — CID 70415144
dimethyl 3-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 70415144) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is dimethyl 3-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70415144 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | dimethyl 3-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)C(C(=O)OC)(c2nc(-c3ccc(O)c(O)c3)cs2)C1c1ccccc1 |
| InChI | InChI=1S/C26H26N2O6S/c1-14-21(23(31)33-3)22(16-8-6-5-7-9-16)26(15(2)27-14,25(32)34-4)24-28-18(13-35-24)17-10-11-19(29)20(30)12-17/h5-13,15,22,27,29-30H,1-4H3 |
| InChIKey | LCUZUAUGVKINLM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|