About N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one
N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 70415225) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one |
| PubChem CID | 70415225 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N(CC)CC.C=CC(=O)N1CCCC1 |
| InChI | InChI=1S/C7H11NO.C7H13NO/c1-2-7(9)8-5-3-4-6-8;1-4-7(9)8(5-2)6-3/h2H,1,3-6H2;4H,1,5-6H2,2-3H3 |
| InChIKey | BEKOQQLZZCWRJI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one?
The IUPAC name of N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one (CID 70415225) is N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one.
What is the SMILES notation for N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one?
The canonical SMILES for N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one is C=CC(=O)N(CC)CC.C=CC(=O)N1CCCC1.
What is the InChIKey of N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one?
The InChIKey is BEKOQQLZZCWRJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C7H13NO/c1-2-7(9)8-5-3-4-6-8;1-4-7(9)8(5-2)6-3/h2H,1,3-6H2;4H,1,5-6H2,2-3H3.
What are the key properties of N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one?
N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one has a molecular weight of 252.36 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylprop-2-enamide;1-pyrrolidin-1-ylprop-2-en-1-one is sourced from PubChem (CID 70415225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).