About ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate
ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate (PubChem CID 70415279) has the molecular formula C27H25N5O3
and a molecular weight of 467.53 g/mol. Its IUPAC name is ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate |
| PubChem CID | 70415279 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn([C@@H]2NC(=O)[C@H]2NC(c2ccccc2)(c2ccccc2)c2ccccc2)nn1 |
| InChI | InChI=1S/C27H25N5O3/c1-2-35-26(34)22-18-32(31-30-22)24-23(25(33)28-24)29-27(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18,23-24,29H,2H2,1H3,(H,28,33)/t23-,24-/m0/s1 |
| InChIKey | KQTMAMQTVNZGKZ-ZEQRLZLVSA-N |
| XLogP | 3.03 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
The IUPAC name of ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate (CID 70415279) is ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate.
What is the SMILES notation for ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
The canonical SMILES for ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate is CCOC(=O)c1cn([C@@H]2NC(=O)[C@H]2NC(c2ccccc2)(c2ccccc2)c2ccccc2)nn1.
What is the InChIKey of ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
The InChIKey is KQTMAMQTVNZGKZ-ZEQRLZLVSA-N. The full InChI is InChI=1S/C27H25N5O3/c1-2-35-26(34)22-18-32(31-30-22)24-23(25(33)28-24)29-27(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18,23-24,29H,2H2,1H3,(H,28,33)/t23-,24-/m0/s1.
What are the key properties of ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate has a molecular weight of 467.53 g/mol, XLogP of 3.03, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate is sourced from PubChem (CID 70415279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).