C22H29NO2 — CID 70415403
4-[1-(4-hydroxyphenyl)propan-2-yl-propylamino]-1-phenylbutan-1-one (PubChem CID 70415403) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)propan-2-yl-propylamino]-1-phenylbutan-1-one.
| Compound Name | 4-[1-(4-hydroxyphenyl)propan-2-yl-propylamino]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 70415403 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)propan-2-yl-propylamino]-1-phenylbutan-1-one |
| SMILES | CCCN(CCCC(=O)c1ccccc1)C(C)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-3-15-23(18(2)17-19-11-13-21(24)14-12-19)16-7-10-22(25)20-8-5-4-6-9-20/h4-6,8-9,11-14,18,24H,3,7,10,15-17H2,1-2H3 |
| InChIKey | AFQJVXJYZMYTIJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |