C12H16N6O7 — CID 70415864
3-hydroxy-4-(5-oxo-1,2-dihydropyrrol-3-yl)-1,2-dihydropyrrol-5-one;oxamide (PubChem CID 70415864) has the molecular formula C12H16N6O7 and a molecular weight of 356.30 g/mol. Its IUPAC name is 3-hydroxy-4-(5-oxo-1,2-dihydropyrrol-3-yl)-1,2-dihydropyrrol-5-one;oxamide.
| Compound Name | 3-hydroxy-4-(5-oxo-1,2-dihydropyrrol-3-yl)-1,2-dihydropyrrol-5-one;oxamide |
|---|---|
| PubChem CID | 70415864 |
| Molecular Formula | C12H16N6O7 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-hydroxy-4-(5-oxo-1,2-dihydropyrrol-3-yl)-1,2-dihydropyrrol-5-one;oxamide |
| SMILES | NC(=O)C(N)=O.NC(=O)C(N)=O.O=C1C=C(C2=C(O)CNC2=O)CN1 |
| InChI | InChI=1S/C8H8N2O3.2C2H4N2O2/c11-5-3-10-8(13)7(5)4-1-6(12)9-2-4;2*3-1(5)2(4)6/h1,11H,2-3H2,(H,9,12)(H,10,13);2*(H2,3,5)(H2,4,6) |
| InChIKey | HDZCNNRBHQVLTK-UHFFFAOYSA-N |
| XLogP | -5.10 |
| TPSA | 250.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | -5.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|