About azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate
azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate (PubChem CID 70416083) has the molecular formula C22H39N2O5P
and a molecular weight of 442.54 g/mol. Its IUPAC name is azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate |
| PubChem CID | 70416083 |
| Molecular Formula | C22H39N2O5P |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate |
| SMILES | CCCN(CCCC(=O)C1CCCCC1)C(C)Cc1ccc(OP(=O)(O)O)cc1.N |
| InChI | InChI=1S/C22H36NO5P.H3N/c1-3-15-23(16-7-10-22(24)20-8-5-4-6-9-20)18(2)17-19-11-13-21(14-12-19)28-29(25,26)27;/h11-14,18,20H,3-10,15-17H2,1-2H3,(H2,25,26,27);1H3 |
| InChIKey | DYUNWWNBCKYHFI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate?
The IUPAC name of azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate (CID 70416083) is azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate.
What is the SMILES notation for azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate?
The canonical SMILES for azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate is CCCN(CCCC(=O)C1CCCCC1)C(C)Cc1ccc(OP(=O)(O)O)cc1.N.
What is the InChIKey of azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate?
The InChIKey is DYUNWWNBCKYHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36NO5P.H3N/c1-3-15-23(16-7-10-22(24)20-8-5-4-6-9-20)18(2)17-19-11-13-21(14-12-19)28-29(25,26)27;/h11-14,18,20H,3-10,15-17H2,1-2H3,(H2,25,26,27);1H3.
What are the key properties of azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate?
azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate has a molecular weight of 442.54 g/mol, XLogP of 4.89, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[4-[2-[(4-cyclohexyl-4-oxobutyl)-propylamino]propyl]phenyl] dihydrogen phosphate is sourced from PubChem (CID 70416083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).