C6H4N2O4 — CID 70416223
5-(1,2-oxazol-3-yl)-1,3-oxazolidine-2,4-dione (PubChem CID 70416223) has the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-yl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(1,2-oxazol-3-yl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 70416223 |
| Molecular Formula | C6H4N2O4 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 5-(1,2-oxazol-3-yl)-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccon2)O1 |
| InChI | InChI=1S/C6H4N2O4/c9-5-4(12-6(10)7-5)3-1-2-11-8-3/h1-2,4H,(H,7,9,10) |
| InChIKey | HFFDGUXVNLMFCJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |