About [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate
[(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate (PubChem CID 70416266) has the molecular formula C14H16FNO3
and a molecular weight of 265.28 g/mol. Its IUPAC name is [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate |
| PubChem CID | 70416266 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@@H](C)F)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H16FNO3/c1-9(15)12-13(18)16(14(12)19-10(2)17)8-11-6-4-3-5-7-11/h3-7,9,12,14H,8H2,1-2H3/t9-,12+,14+/m1/s1 |
| InChIKey | ABDIAYZJILKZMW-LQJRIPTKSA-N |
| XLogP | 1.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate?
The IUPAC name of [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate (CID 70416266) is [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate.
What is the SMILES notation for [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate?
The canonical SMILES for [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate is CC(=O)O[C@H]1[C@@H]([C@@H](C)F)C(=O)N1Cc1ccccc1.
What is the InChIKey of [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate?
The InChIKey is ABDIAYZJILKZMW-LQJRIPTKSA-N. The full InChI is InChI=1S/C14H16FNO3/c1-9(15)12-13(18)16(14(12)19-10(2)17)8-11-6-4-3-5-7-11/h3-7,9,12,14H,8H2,1-2H3/t9-,12+,14+/m1/s1.
What are the key properties of [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate?
[(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate has a molecular weight of 265.28 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-1-benzyl-3-[(1R)-1-fluoroethyl]-4-oxoazetidin-2-yl] acetate is sourced from PubChem (CID 70416266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).