About (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid
(3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 70416362) has the molecular formula C11H9N3O6S
and a molecular weight of 311.28 g/mol. Its IUPAC name is (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid.
Molecular Properties
| Compound Name | (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid |
| PubChem CID | 70416362 |
| Molecular Formula | C11H9N3O6S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | N[C@@H]1C(=O)N(S(=O)(=O)O)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H9N3O6S/c12-7-8(14(11(7)17)21(18,19)20)13-9(15)5-3-1-2-4-6(5)10(13)16/h1-4,7-8H,12H2,(H,18,19,20)/t7-,8?/m0/s1 |
| InChIKey | SDFXKWAVAXQDFK-JAMMHHFISA-N |
| XLogP | -1.42 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid?
The IUPAC name of (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid (CID 70416362) is (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid.
What is the SMILES notation for (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid?
The canonical SMILES for (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid is N[C@@H]1C(=O)N(S(=O)(=O)O)C1N1C(=O)c2ccccc2C1=O.
What is the InChIKey of (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid?
The InChIKey is SDFXKWAVAXQDFK-JAMMHHFISA-N. The full InChI is InChI=1S/C11H9N3O6S/c12-7-8(14(11(7)17)21(18,19)20)13-9(15)5-3-1-2-4-6(5)10(13)16/h1-4,7-8H,12H2,(H,18,19,20)/t7-,8?/m0/s1.
What are the key properties of (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid?
(3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid has a molecular weight of 311.28 g/mol, XLogP of -1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-1-sulfonic acid is sourced from PubChem (CID 70416362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).