C11H14N2 — CID 70416496
2,4a,4b,8a,9,9a-hexahydro-1H-pyrido[3,4-b]indole (PubChem CID 70416496) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,4a,4b,8a,9,9a-hexahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 2,4a,4b,8a,9,9a-hexahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 70416496 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,4a,4b,8a,9,9a-hexahydro-1H-pyrido[3,4-b]indole |
| SMILES | C1=CC2NC3CNC=CC3C2C=C1 |
| InChI | InChI=1S/C11H14N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-6,8-13H,7H2 |
| InChIKey | IRZPTMAZEOOSJP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |