About 1H-imidazole;3-methylimidazole-4-carboxylic acid
1H-imidazole;3-methylimidazole-4-carboxylic acid (PubChem CID 70416851) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 1H-imidazole;3-methylimidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1H-imidazole;3-methylimidazole-4-carboxylic acid |
| PubChem CID | 70416851 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1H-imidazole;3-methylimidazole-4-carboxylic acid |
| SMILES | Cn1cncc1C(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C5H6N2O2.C3H4N2/c1-7-3-6-2-4(7)5(8)9;1-2-5-3-4-1/h2-3H,1H3,(H,8,9);1-3H,(H,4,5) |
| InChIKey | FBPNIIQKHRRGKC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-imidazole;3-methylimidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;3-methylimidazole-4-carboxylic acid?
The IUPAC name of 1H-imidazole;3-methylimidazole-4-carboxylic acid (CID 70416851) is 1H-imidazole;3-methylimidazole-4-carboxylic acid.
What is the SMILES notation for 1H-imidazole;3-methylimidazole-4-carboxylic acid?
The canonical SMILES for 1H-imidazole;3-methylimidazole-4-carboxylic acid is Cn1cncc1C(=O)O.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;3-methylimidazole-4-carboxylic acid?
The InChIKey is FBPNIIQKHRRGKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.C3H4N2/c1-7-3-6-2-4(7)5(8)9;1-2-5-3-4-1/h2-3H,1H3,(H,8,9);1-3H,(H,4,5).
What are the key properties of 1H-imidazole;3-methylimidazole-4-carboxylic acid?
1H-imidazole;3-methylimidazole-4-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;3-methylimidazole-4-carboxylic acid is sourced from PubChem (CID 70416851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).