C11H11Cl2N3O2 — CID 70416921
1-[(2-chlorophenyl)methyl]-5-methyltriazole-4-carboxylic acid;hydrochloride (PubChem CID 70416921) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5-methyltriazole-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[(2-chlorophenyl)methyl]-5-methyltriazole-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70416921 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5-methyltriazole-4-carboxylic acid;hydrochloride |
| SMILES | Cc1c(C(=O)O)nnn1Cc1ccccc1Cl.Cl |
| InChI | InChI=1S/C11H10ClN3O2.ClH/c1-7-10(11(16)17)13-14-15(7)6-8-4-2-3-5-9(8)12;/h2-5H,6H2,1H3,(H,16,17);1H |
| InChIKey | GKKCYKGJUOZRMB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |