C17H23N3O8 — CID 70416932
3-amino-4-[(2-aminophenyl)methylamino]-3,4-bis(carboxymethyl)hexanedioic acid (PubChem CID 70416932) has the molecular formula C17H23N3O8 and a molecular weight of 397.38 g/mol. Its IUPAC name is 3-amino-4-[(2-aminophenyl)methylamino]-3,4-bis(carboxymethyl)hexanedioic acid.
| Compound Name | 3-amino-4-[(2-aminophenyl)methylamino]-3,4-bis(carboxymethyl)hexanedioic acid |
|---|---|
| PubChem CID | 70416932 |
| Molecular Formula | C17H23N3O8 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-amino-4-[(2-aminophenyl)methylamino]-3,4-bis(carboxymethyl)hexanedioic acid |
| SMILES | Nc1ccccc1CNC(CC(=O)O)(CC(=O)O)C(N)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C17H23N3O8/c18-11-4-2-1-3-10(11)9-20-17(7-14(25)26,8-15(27)28)16(19,5-12(21)22)6-13(23)24/h1-4,20H,5-9,18-19H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | FSMXZXWLGSBIQO-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 213.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|