C20H18N2O3 — CID 704170
methyl 5-(2-cyano-5-phenylpenta-2,4-dienoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 704170) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 5-(2-cyano-5-phenylpenta-2,4-dienoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-(2-cyano-5-phenylpenta-2,4-dienoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 704170 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 5-(2-cyano-5-phenylpenta-2,4-dienoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)C(C#N)=CC=Cc2ccccc2)c1C |
| InChI | InChI=1S/C20H18N2O3/c1-13-17(20(24)25-3)14(2)22-18(13)19(23)16(12-21)11-7-10-15-8-5-4-6-9-15/h4-11,22H,1-3H3 |
| InChIKey | UHYWANDEDCDFTR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|