About 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one
2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one (PubChem CID 70417080) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one.
Molecular Properties
| Compound Name | 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one |
| PubChem CID | 70417080 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one |
| SMILES | CNN1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C8H9N3OS/c1-9-11-8(12)10-6-4-2-3-5-7(6)13-11/h2-5,9H,1H3,(H,10,12) |
| InChIKey | ZREHUIFFDWYYKZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one?
The IUPAC name of 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one (CID 70417080) is 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one.
What is the SMILES notation for 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one?
The canonical SMILES for 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one is CNN1Sc2ccccc2NC1=O.
What is the InChIKey of 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one?
The InChIKey is ZREHUIFFDWYYKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-9-11-8(12)10-6-4-2-3-5-7(6)13-11/h2-5,9H,1H3,(H,10,12).
What are the key properties of 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one?
2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one has a molecular weight of 195.25 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-4H-1,2,4-benzothiadiazin-3-one is sourced from PubChem (CID 70417080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).