About N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide
N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide (PubChem CID 70417144) has the molecular formula C10H22N6OS
and a molecular weight of 274.39 g/mol. Its IUPAC name is N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide |
| PubChem CID | 70417144 |
| Molecular Formula | C10H22N6OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide |
| SMILES | CCN(CC)CC.NC(=O)CCn1[nH]nnc1=S |
| InChI | InChI=1S/C6H15N.C4H7N5OS/c1-4-7(5-2)6-3;5-3(10)1-2-9-4(11)6-7-8-9/h4-6H2,1-3H3;1-2H2,(H2,5,10)(H,6,8,11) |
| InChIKey | XNRAPUKCXSAORT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide?
The IUPAC name of N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide (CID 70417144) is N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide.
What is the SMILES notation for N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide?
The canonical SMILES for N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide is CCN(CC)CC.NC(=O)CCn1[nH]nnc1=S.
What is the InChIKey of N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide?
The InChIKey is XNRAPUKCXSAORT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H7N5OS/c1-4-7(5-2)6-3;5-3(10)1-2-9-4(11)6-7-8-9/h4-6H2,1-3H3;1-2H2,(H2,5,10)(H,6,8,11).
What are the key properties of N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide?
N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide has a molecular weight of 274.39 g/mol, XLogP of 0.56, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;3-(5-sulfanylidene-2H-tetrazol-1-yl)propanamide is sourced from PubChem (CID 70417144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).