About 2-methoxy-4,4-dimethylthiolan-3-one
2-methoxy-4,4-dimethylthiolan-3-one (PubChem CID 70417327) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-methoxy-4,4-dimethylthiolan-3-one.
Molecular Properties
| Compound Name | 2-methoxy-4,4-dimethylthiolan-3-one |
| PubChem CID | 70417327 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2-methoxy-4,4-dimethylthiolan-3-one |
| SMILES | COC1SCC(C)(C)C1=O |
| InChI | InChI=1S/C7H12O2S/c1-7(2)4-10-6(9-3)5(7)8/h6H,4H2,1-3H3 |
| InChIKey | AHUKUDHRAHATCY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-4,4-dimethylthiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,4-dimethylthiolan-3-one?
The IUPAC name of 2-methoxy-4,4-dimethylthiolan-3-one (CID 70417327) is 2-methoxy-4,4-dimethylthiolan-3-one.
What is the SMILES notation for 2-methoxy-4,4-dimethylthiolan-3-one?
The canonical SMILES for 2-methoxy-4,4-dimethylthiolan-3-one is COC1SCC(C)(C)C1=O.
What is the InChIKey of 2-methoxy-4,4-dimethylthiolan-3-one?
The InChIKey is AHUKUDHRAHATCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S/c1-7(2)4-10-6(9-3)5(7)8/h6H,4H2,1-3H3.
What are the key properties of 2-methoxy-4,4-dimethylthiolan-3-one?
2-methoxy-4,4-dimethylthiolan-3-one has a molecular weight of 160.24 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,4-dimethylthiolan-3-one is sourced from PubChem (CID 70417327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).