About [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium
[(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium (PubChem CID 7041738) has the molecular formula C17H22BrN2O3+
and a molecular weight of 382.28 g/mol. Its IUPAC name is [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium.
Molecular Properties
| Compound Name | [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium |
| PubChem CID | 7041738 |
| Molecular Formula | C17H22BrN2O3+ |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium |
| SMILES | C=C([NH3+])[C@H](C#N)C(=O)COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C17H21BrN2O3/c1-10(20)13(7-19)14(21)8-23-15(22)16-3-11-2-12(4-16)6-17(18,5-11)9-16/h11-13H,1-6,8-9,20H2/p+1/t11-,12+,13-,16?,17?/m0/s1 |
| InChIKey | QKLUFKKJCZSWBF-ZYJSHVEQSA-O |
| XLogP | 1.73 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium?
The IUPAC name of [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium (CID 7041738) is [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium.
What is the SMILES notation for [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium?
The canonical SMILES for [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium is C=C([NH3+])[C@H](C#N)C(=O)COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2.
What is the InChIKey of [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium?
The InChIKey is QKLUFKKJCZSWBF-ZYJSHVEQSA-O. The full InChI is InChI=1S/C17H21BrN2O3/c1-10(20)13(7-19)14(21)8-23-15(22)16-3-11-2-12(4-16)6-17(18,5-11)9-16/h11-13H,1-6,8-9,20H2/p+1/t11-,12+,13-,16?,17?/m0/s1.
What are the key properties of [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium?
[(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium has a molecular weight of 382.28 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-5-[(5S,7R)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium is sourced from PubChem (CID 7041738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).