C21H23N5O2 — CID 70417765
(6aR,9R)-4-(hydroxymethyl)-7-methyl-N-pyrazin-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 70417765) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (6aR,9R)-4-(hydroxymethyl)-7-methyl-N-pyrazin-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-4-(hydroxymethyl)-7-methyl-N-pyrazin-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 70417765 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (6aR,9R)-4-(hydroxymethyl)-7-methyl-N-pyrazin-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CN1C[C@H](C(=O)Nc2cnccn2)CC2c3cccc4c3c(cn4CO)C[C@H]21 |
| InChI | InChI=1S/C21H23N5O2/c1-25-10-14(21(28)24-19-9-22-5-6-23-19)7-16-15-3-2-4-17-20(15)13(8-18(16)25)11-26(17)12-27/h2-6,9,11,14,16,18,27H,7-8,10,12H2,1H3,(H,23,24,28)/t14-,16?,18-/m1/s1 |
| InChIKey | INOFRKLLWQKJSC-OXPKRCOGSA-N |
| XLogP | 1.98 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|