About cyclopropanecarboxylic acid;3,4-dichloroaniline
cyclopropanecarboxylic acid;3,4-dichloroaniline (PubChem CID 70417782) has the molecular formula C10H11Cl2NO2
and a molecular weight of 248.11 g/mol. Its IUPAC name is cyclopropanecarboxylic acid;3,4-dichloroaniline.
Molecular Properties
| Compound Name | cyclopropanecarboxylic acid;3,4-dichloroaniline |
| PubChem CID | 70417782 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | cyclopropanecarboxylic acid;3,4-dichloroaniline |
| SMILES | Nc1ccc(Cl)c(Cl)c1.O=C(O)C1CC1 |
| InChI | InChI=1S/C6H5Cl2N.C4H6O2/c7-5-2-1-4(9)3-6(5)8;5-4(6)3-1-2-3/h1-3H,9H2;3H,1-2H2,(H,5,6) |
| InChIKey | RGSVWQAFXSCDNA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanecarboxylic acid;3,4-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarboxylic acid;3,4-dichloroaniline?
The IUPAC name of cyclopropanecarboxylic acid;3,4-dichloroaniline (CID 70417782) is cyclopropanecarboxylic acid;3,4-dichloroaniline.
What is the SMILES notation for cyclopropanecarboxylic acid;3,4-dichloroaniline?
The canonical SMILES for cyclopropanecarboxylic acid;3,4-dichloroaniline is Nc1ccc(Cl)c(Cl)c1.O=C(O)C1CC1.
What is the InChIKey of cyclopropanecarboxylic acid;3,4-dichloroaniline?
The InChIKey is RGSVWQAFXSCDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N.C4H6O2/c7-5-2-1-4(9)3-6(5)8;5-4(6)3-1-2-3/h1-3H,9H2;3H,1-2H2,(H,5,6).
What are the key properties of cyclopropanecarboxylic acid;3,4-dichloroaniline?
cyclopropanecarboxylic acid;3,4-dichloroaniline has a molecular weight of 248.11 g/mol, XLogP of 3.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarboxylic acid;3,4-dichloroaniline is sourced from PubChem (CID 70417782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).