About N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine
N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine (PubChem CID 70417806) has the molecular formula C16H29N3
and a molecular weight of 263.43 g/mol. Its IUPAC name is N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine.
Molecular Properties
| Compound Name | N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine |
| PubChem CID | 70417806 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine |
| SMILES | CC=C1C=CC=CC1/N=C/C.CCCCCC(N)N |
| InChI | InChI=1S/C10H13N.C6H16N2/c1-3-9-7-5-6-8-10(9)11-4-2;1-2-3-4-5-6(7)8/h3-8,10H,1-2H3;6H,2-5,7-8H2,1H3/b9-3?,11-4+; |
| InChIKey | HBAGHTLDJHTWKL-RJOPALHJSA-N |
| XLogP | 3.33 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine?
The IUPAC name of N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine (CID 70417806) is N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine.
What is the SMILES notation for N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine?
The canonical SMILES for N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine is CC=C1C=CC=CC1/N=C/C.CCCCCC(N)N.
What is the InChIKey of N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine?
The InChIKey is HBAGHTLDJHTWKL-RJOPALHJSA-N. The full InChI is InChI=1S/C10H13N.C6H16N2/c1-3-9-7-5-6-8-10(9)11-4-2;1-2-3-4-5-6(7)8/h3-8,10H,1-2H3;6H,2-5,7-8H2,1H3/b9-3?,11-4+;.
What are the key properties of N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine?
N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine has a molecular weight of 263.43 g/mol, XLogP of 3.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine;hexane-1,1-diamine is sourced from PubChem (CID 70417806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).