About (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione
(4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione (PubChem CID 70417902) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione.
Molecular Properties
| Compound Name | (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione |
| PubChem CID | 70417902 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione |
| SMILES | CCCCC/C1=C/C(=O)C2C=CC=C/C2=N/C(=O)C1 |
| InChI | InChI=1S/C16H19NO2/c1-2-3-4-7-12-10-15(18)13-8-5-6-9-14(13)17-16(19)11-12/h5-6,8-10,13H,2-4,7,11H2,1H3/b12-10-,17-14- |
| InChIKey | UTBKKSQSTLSUJR-PRPHQEAXSA-N |
| XLogP | 3.18 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione?
The IUPAC name of (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione (CID 70417902) is (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione.
What is the SMILES notation for (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione?
The canonical SMILES for (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione is CCCCC/C1=C/C(=O)C2C=CC=C/C2=N/C(=O)C1.
What is the InChIKey of (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione?
The InChIKey is UTBKKSQSTLSUJR-PRPHQEAXSA-N. The full InChI is InChI=1S/C16H19NO2/c1-2-3-4-7-12-10-15(18)13-8-5-6-9-14(13)17-16(19)11-12/h5-6,8-10,13H,2-4,7,11H2,1H3/b12-10-,17-14-.
What are the key properties of (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione?
(4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione has a molecular weight of 257.33 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-pentyl-3,6a-dihydro-1-benzazocine-2,6-dione is sourced from PubChem (CID 70417902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).