About 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate
2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate (PubChem CID 7041795) has the molecular formula C16H13N2O2S-
and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate.
Molecular Properties
| Compound Name | 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate |
| PubChem CID | 7041795 |
| Molecular Formula | C16H13N2O2S- |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate |
| SMILES | Cc1cccc2nc(CSc3ccccc3C(=O)[O-])cn12 |
| InChI | InChI=1S/C16H14N2O2S/c1-11-5-4-8-15-17-12(9-18(11)15)10-21-14-7-3-2-6-13(14)16(19)20/h2-9H,10H2,1H3,(H,19,20)/p-1 |
| InChIKey | OBIJAFKZFWAIIE-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate?
The IUPAC name of 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate (CID 7041795) is 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate.
What is the SMILES notation for 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate?
The canonical SMILES for 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate is Cc1cccc2nc(CSc3ccccc3C(=O)[O-])cn12.
What is the InChIKey of 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate?
The InChIKey is OBIJAFKZFWAIIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H14N2O2S/c1-11-5-4-8-15-17-12(9-18(11)15)10-21-14-7-3-2-6-13(14)16(19)20/h2-9H,10H2,1H3,(H,19,20)/p-1.
What are the key properties of 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate?
2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate has a molecular weight of 297.36 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoate is sourced from PubChem (CID 7041795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).