C37H36N4O4 — CID 70418385
3-[22-benzyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoic acid (PubChem CID 70418385) has the molecular formula C37H36N4O4 and a molecular weight of 600.72 g/mol. Its IUPAC name is 3-[22-benzyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[22-benzyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 70418385 |
| Molecular Formula | C37H36N4O4 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 3-[22-benzyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4c(C)cc(cc5[nH]c(cc1n2)cc5C)n4Cc1ccccc1)C(C)=C3CCC(=O)O |
| InChI | InChI=1S/C37H36N4O4/c1-21-14-26-16-31-23(3)28(10-12-36(42)43)33(39-31)18-34-29(11-13-37(44)45)24(4)32(40-34)19-35-22(2)15-27(17-30(21)38-26)41(35)20-25-8-6-5-7-9-25/h5-9,14-19,38H,10-13,20H2,1-4H3,(H,42,43)(H,44,45)/b26-16-,27-17-,30-17-,31-16-,32-19-,33-18-,34-18-,35-19- |
| InChIKey | TXDTYPSHSQRXHO-KVHJVMGFSA-N |
| XLogP | 8.04 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |