C32H41ClN2O7S — CID 70418417
(E)-but-2-enedioic acid;7-chloro-2-[2-[5-[cyclohexyl(methyl)amino]pentoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 70418417) has the molecular formula C32H41ClN2O7S and a molecular weight of 633.21 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;7-chloro-2-[2-[5-[cyclohexyl(methyl)amino]pentoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | (E)-but-2-enedioic acid;7-chloro-2-[2-[5-[cyclohexyl(methyl)amino]pentoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 70418417 |
| Molecular Formula | C32H41ClN2O7S |
| Molecular Weight | 633.21 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | (E)-but-2-enedioic acid;7-chloro-2-[2-[5-[cyclohexyl(methyl)amino]pentoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCCCCN(C)C2CCCCC2)c(C2Sc3cc(Cl)ccc3N(C)C2=O)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H37ClN2O3S.C4H4O4/c1-30(21-10-6-4-7-11-21)16-8-5-9-17-34-25-15-13-22(33-3)19-23(25)27-28(32)31(2)24-14-12-20(29)18-26(24)35-27;5-3(6)1-2-4(7)8/h12-15,18-19,21,27H,4-11,16-17H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GZAWVNVJVSKMIH-WLHGVMLRSA-N |
| XLogP | 6.68 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.21 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|