About 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol
2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol (PubChem CID 70418628) has the molecular formula C27H32N4O3
and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol |
| PubChem CID | 70418628 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol |
| SMILES | Cc1cc(NCCN2CCC(O)CC2C(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C27H32N4O3/c1-19-17-24(27(31(33)34)20(2)29-19)28-14-16-30-15-13-23(32)18-25(30)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,17,23,25-26,32H,13-16,18H2,1-2H3,(H,28,29) |
| InChIKey | QREUEAXIVXZMJP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol?
The IUPAC name of 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol (CID 70418628) is 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol.
What is the SMILES notation for 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol?
The canonical SMILES for 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol is Cc1cc(NCCN2CCC(O)CC2C(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c(C)n1.
What is the InChIKey of 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol?
The InChIKey is QREUEAXIVXZMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N4O3/c1-19-17-24(27(31(33)34)20(2)29-19)28-14-16-30-15-13-23(32)18-25(30)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,17,23,25-26,32H,13-16,18H2,1-2H3,(H,28,29).
What are the key properties of 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol?
2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol has a molecular weight of 460.58 g/mol, XLogP of 4.68, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryl-1-[2-[(2,6-dimethyl-3-nitro-4-pyridinyl)amino]ethyl]piperidin-4-ol is sourced from PubChem (CID 70418628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).