About 2-acetyl-4,5-dimethylfuran-3-one
2-acetyl-4,5-dimethylfuran-3-one (PubChem CID 70418702) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-acetyl-4,5-dimethylfuran-3-one.
Molecular Properties
| Compound Name | 2-acetyl-4,5-dimethylfuran-3-one |
| PubChem CID | 70418702 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-acetyl-4,5-dimethylfuran-3-one |
| SMILES | CC(=O)C1OC(C)=C(C)C1=O |
| InChI | InChI=1S/C8H10O3/c1-4-6(3)11-8(5(2)9)7(4)10/h8H,1-3H3 |
| InChIKey | FKVYKZQPQJYUCP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-4,5-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-4,5-dimethylfuran-3-one?
The IUPAC name of 2-acetyl-4,5-dimethylfuran-3-one (CID 70418702) is 2-acetyl-4,5-dimethylfuran-3-one.
What is the SMILES notation for 2-acetyl-4,5-dimethylfuran-3-one?
The canonical SMILES for 2-acetyl-4,5-dimethylfuran-3-one is CC(=O)C1OC(C)=C(C)C1=O.
What is the InChIKey of 2-acetyl-4,5-dimethylfuran-3-one?
The InChIKey is FKVYKZQPQJYUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-4-6(3)11-8(5(2)9)7(4)10/h8H,1-3H3.
What are the key properties of 2-acetyl-4,5-dimethylfuran-3-one?
2-acetyl-4,5-dimethylfuran-3-one has a molecular weight of 154.16 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-4,5-dimethylfuran-3-one is sourced from PubChem (CID 70418702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).