C17H23NO — CID 70418773
11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-trien-12-one (PubChem CID 70418773) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-trien-12-one.
| Compound Name | 11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-trien-12-one |
|---|---|
| PubChem CID | 70418773 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 11-pentyl-11-azatricyclo[6.4.1.04,13]trideca-1(13),7,9-trien-12-one |
| SMILES | CCCCCN1C=CC2=CCCC3CCC(=C23)C1=O |
| InChI | InChI=1S/C17H23NO/c1-2-3-4-11-18-12-10-14-7-5-6-13-8-9-15(16(13)14)17(18)19/h7,10,12-13H,2-6,8-9,11H2,1H3 |
| InChIKey | PLQDUPLLSLRCSQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|