C14H19ClN5NaO8S2 — CID 70419283
sodium (2R,3R)-3-[[3-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonate (PubChem CID 70419283) has the molecular formula C14H19ClN5NaO8S2 and a molecular weight of 507.91 g/mol. Its IUPAC name is sodium (2R,3R)-3-[[3-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2R,3R)-3-[[3-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 70419283 |
| Molecular Formula | C14H19ClN5NaO8S2 |
| Molecular Weight | 507.91 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | sodium (2R,3R)-3-[[3-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC(CCl)C(=O)N[C@@H]2C(=O)N(S(=O)(=O)[O-])[C@@H]2SC)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C14H20ClN5O8S2.Na/c1-3-18-4-5-19(12(24)11(18)23)14(25)16-7(6-15)9(21)17-8-10(22)20(13(8)29-2)30(26,27)28;/h7-8,13H,3-6H2,1-2H3,(H,16,25)(H,17,21)(H,26,27,28);/q;+1/p-1/t7?,8-,13-;/m1./s1 |
| InChIKey | RLMNHNZZBUFGGK-SMNZVZNTSA-M |
| XLogP | -5.53 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.91 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|