About ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate
ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate (PubChem CID 70419314) has the molecular formula C21H26N2O5
and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate |
| PubChem CID | 70419314 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C(C#N)=C1\CCC2CCC1N2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-5-28-21(24)16(12-22)15-8-6-13-7-9-17(15)23(13)14-10-18(25-2)20(27-4)19(11-14)26-3/h10-11,13,17H,5-9H2,1-4H3/b16-15+ |
| InChIKey | ZANCDTAJIVNEOO-FOCLMDBBSA-N |
| XLogP | 3.23 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate?
The IUPAC name of ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate (CID 70419314) is ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate.
What is the SMILES notation for ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate?
The canonical SMILES for ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate is CCOC(=O)/C(C#N)=C1\CCC2CCC1N2c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate?
The InChIKey is ZANCDTAJIVNEOO-FOCLMDBBSA-N. The full InChI is InChI=1S/C21H26N2O5/c1-5-28-21(24)16(12-22)15-8-6-13-7-9-17(15)23(13)14-10-18(25-2)20(27-4)19(11-14)26-3/h10-11,13,17H,5-9H2,1-4H3/b16-15+.
What are the key properties of ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate?
ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate has a molecular weight of 386.45 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-2-ylidene]acetate is sourced from PubChem (CID 70419314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).