C23H30O7 — CID 70419544
[(1S,5R,11S,12R,14R,17R)-14-ethenyl-8,8,12,14,17-pentamethyl-3,16-dioxo-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadec-9-en-11-yl] acetate (PubChem CID 70419544) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(1S,5R,11S,12R,14R,17R)-14-ethenyl-8,8,12,14,17-pentamethyl-3,16-dioxo-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadec-9-en-11-yl] acetate.
| Compound Name | [(1S,5R,11S,12R,14R,17R)-14-ethenyl-8,8,12,14,17-pentamethyl-3,16-dioxo-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadec-9-en-11-yl] acetate |
|---|---|
| PubChem CID | 70419544 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(1S,5R,11S,12R,14R,17R)-14-ethenyl-8,8,12,14,17-pentamethyl-3,16-dioxo-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadec-9-en-11-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]23OC(=O)O[C@@H]4CCC(C)(C)C(=C[C@H](OC(C)=O)[C@@]2(C)O1)[C@]43C |
| InChI | InChI=1S/C23H30O7/c1-8-20(5)12-15(25)23-21(6)14(11-17(27-13(2)24)22(23,7)30-20)19(3,4)10-9-16(21)28-18(26)29-23/h8,11,16-17H,1,9-10,12H2,2-7H3/t16-,17+,20+,21-,22-,23+/m1/s1 |
| InChIKey | GJPXIDFFJCBGOC-MXRGUQQCSA-N |
| XLogP | 3.65 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|