C9H10N2O2S2 — CID 70419813
2-(3-methoxy-5-methylsulfinylthiophen-2-yl)-1H-imidazole (PubChem CID 70419813) has the molecular formula C9H10N2O2S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(3-methoxy-5-methylsulfinylthiophen-2-yl)-1H-imidazole.
| Compound Name | 2-(3-methoxy-5-methylsulfinylthiophen-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 70419813 |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-(3-methoxy-5-methylsulfinylthiophen-2-yl)-1H-imidazole |
| SMILES | COc1cc(S(C)=O)sc1-c1ncc[nH]1 |
| InChI | InChI=1S/C9H10N2O2S2/c1-13-6-5-7(15(2)12)14-8(6)9-10-3-4-11-9/h3-5H,1-2H3,(H,10,11) |
| InChIKey | KYBDTFXOVMCDMH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |