About benzylbenzene;1H-1,2,4-triazole
benzylbenzene;1H-1,2,4-triazole (PubChem CID 70419885) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is benzylbenzene;1H-1,2,4-triazole.
Molecular Properties
| Compound Name | benzylbenzene;1H-1,2,4-triazole |
| PubChem CID | 70419885 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | benzylbenzene;1H-1,2,4-triazole |
| SMILES | c1ccc(Cc2ccccc2)cc1.c1nc[nH]n1 |
| InChI | InChI=1S/C13H12.C2H3N3/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-2-5-4-1/h1-10H,11H2;1-2H,(H,3,4,5) |
| InChIKey | KALADUYFIDIKAG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylbenzene;1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;1H-1,2,4-triazole?
The IUPAC name of benzylbenzene;1H-1,2,4-triazole (CID 70419885) is benzylbenzene;1H-1,2,4-triazole.
What is the SMILES notation for benzylbenzene;1H-1,2,4-triazole?
The canonical SMILES for benzylbenzene;1H-1,2,4-triazole is c1ccc(Cc2ccccc2)cc1.c1nc[nH]n1.
What is the InChIKey of benzylbenzene;1H-1,2,4-triazole?
The InChIKey is KALADUYFIDIKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C2H3N3/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-2-5-4-1/h1-10H,11H2;1-2H,(H,3,4,5).
What are the key properties of benzylbenzene;1H-1,2,4-triazole?
benzylbenzene;1H-1,2,4-triazole has a molecular weight of 237.31 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;1H-1,2,4-triazole is sourced from PubChem (CID 70419885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).