C25H46N4O — CID 70420025
2,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hepta-2,5-dien-4-one (PubChem CID 70420025) has the molecular formula C25H46N4O and a molecular weight of 418.67 g/mol. Its IUPAC name is 2,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hepta-2,5-dien-4-one.
| Compound Name | 2,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 70420025 |
| Molecular Formula | C25H46N4O |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.37 |
| IUPAC Name | 2,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hepta-2,5-dien-4-one |
| SMILES | CC(=CC(=O)C=C(C)NC1CC(C)(C)NC(C)(C)C1)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H46N4O/c1-17(26-19-13-22(3,4)28-23(5,6)14-19)11-21(30)12-18(2)27-20-15-24(7,8)29-25(9,10)16-20/h11-12,19-20,26-29H,13-16H2,1-10H3 |
| InChIKey | DLGMXLBIAPUWCL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|