About 5-methyloxolane-2,3-diimine
5-methyloxolane-2,3-diimine (PubChem CID 70420442) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 5-methyloxolane-2,3-diimine.
Molecular Properties
| Compound Name | 5-methyloxolane-2,3-diimine |
| PubChem CID | 70420442 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 5-methyloxolane-2,3-diimine |
| SMILES | [H]/N=C1\OC(C)C\C1=N/[H] |
| InChI | InChI=1S/C5H8N2O/c1-3-2-4(6)5(7)8-3/h3,6-7H,2H2,1H3/b6-4+,7-5- |
| InChIKey | LONRYMMDHKGSGA-GUBXDBFYSA-N |
| XLogP | 0.79 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyloxolane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloxolane-2,3-diimine?
The IUPAC name of 5-methyloxolane-2,3-diimine (CID 70420442) is 5-methyloxolane-2,3-diimine.
What is the SMILES notation for 5-methyloxolane-2,3-diimine?
The canonical SMILES for 5-methyloxolane-2,3-diimine is [H]/N=C1\OC(C)C\C1=N/[H].
What is the InChIKey of 5-methyloxolane-2,3-diimine?
The InChIKey is LONRYMMDHKGSGA-GUBXDBFYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-3-2-4(6)5(7)8-3/h3,6-7H,2H2,1H3/b6-4+,7-5-.
What are the key properties of 5-methyloxolane-2,3-diimine?
5-methyloxolane-2,3-diimine has a molecular weight of 112.13 g/mol, XLogP of 0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloxolane-2,3-diimine is sourced from PubChem (CID 70420442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).