About 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 70420571) has the molecular formula C8H5N3OS
and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 70420571 |
| Molecular Formula | C8H5N3OS |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC#Cc1nn2c(=O)ccnc2s1 |
| InChI | InChI=1S/C8H5N3OS/c1-2-3-6-10-11-7(12)4-5-9-8(11)13-6/h4-5H,1H3 |
| InChIKey | CVNRHHVIELTMOD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (CID 70420571) is 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one is CC#Cc1nn2c(=O)ccnc2s1.
What is the InChIKey of 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is CVNRHHVIELTMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3OS/c1-2-3-6-10-11-7(12)4-5-9-8(11)13-6/h4-5H,1H3.
What are the key properties of 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one?
2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 191.22 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-ynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 70420571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).