C48H46Cl4N4O2 — CID 70420611
4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)phenyl]-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 70420611) has the molecular formula C48H46Cl4N4O2 and a molecular weight of 852.73 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)phenyl]-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)phenyl]-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 70420611 |
| Molecular Formula | C48H46Cl4N4O2 |
| Molecular Weight | 852.73 g/mol |
| Exact Mass | 850.24 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)phenyl]-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc(/C(=C\C2(/C=C(\c3ccc(N(C)C)cc3)c3ccc(N4CCCC4)cc3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C48H46Cl4N4O2/c1-53(2)35-17-9-31(10-18-35)39(33-13-21-37(22-14-33)55-25-5-6-26-55)29-48(42-41(47(57)58-48)43(49)45(51)46(52)44(42)50)30-40(32-11-19-36(20-12-32)54(3)4)34-15-23-38(24-16-34)56-27-7-8-28-56/h9-24,29-30H,5-8,25-28H2,1-4H3/b39-29+,40-30+ |
| InChIKey | SAQWQXIBILSWDT-NXRKLTDKSA-N |
| XLogP | 12.26 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.73 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|